C18H40N2O2S — CID 130426482
N,N-dimethyl-2-(7-methyltridecan-7-ylamino)ethanesulfonamide (PubChem CID 130426482) has the molecular formula C18H40N2O2S and a molecular weight of 348.60 g/mol. Its IUPAC name is N,N-dimethyl-2-(7-methyltridecan-7-ylamino)ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-(7-methyltridecan-7-ylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 130426482 |
| Molecular Formula | C18H40N2O2S |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | N,N-dimethyl-2-(7-methyltridecan-7-ylamino)ethanesulfonamide |
| SMILES | CCCCCCC(C)(CCCCCC)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C18H40N2O2S/c1-6-8-10-12-14-18(3,15-13-11-9-7-2)19-16-17-23(21,22)20(4)5/h19H,6-17H2,1-5H3 |
| InChIKey | XRRPTYPSSPIWFF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|