C34H55NO3 — CID 130426518
(1Z)-1-[(4aS,6S,8aR)-6-[4-[(1R)-1-(2-hydroxyethyl)-2,4,4-trimethylcyclohexyl]-2-methylbutan-2-yl]-4a,6,9,9-tetramethyl-4,7,8,8a-tetrahydrobenzo[f][1,2]benzoxazol-5-ylidene]propan-2-one (PubChem CID 130426518) has the molecular formula C34H55NO3 and a molecular weight of 525.82 g/mol. Its IUPAC name is (1Z)-1-[(4aS,6S,8aR)-6-[4-[(1R)-1-(2-hydroxyethyl)-2,4,4-trimethylcyclohexyl]-2-methylbutan-2-yl]-4a,6,9,9-tetramethyl-4,7,8,8a-tetrahydrobenzo[f][1,2]benzoxazol-5-ylidene]propan-2-one.
| Compound Name | (1Z)-1-[(4aS,6S,8aR)-6-[4-[(1R)-1-(2-hydroxyethyl)-2,4,4-trimethylcyclohexyl]-2-methylbutan-2-yl]-4a,6,9,9-tetramethyl-4,7,8,8a-tetrahydrobenzo[f][1,2]benzoxazol-5-ylidene]propan-2-one |
|---|---|
| PubChem CID | 130426518 |
| Molecular Formula | C34H55NO3 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.42 |
| IUPAC Name | (1Z)-1-[(4aS,6S,8aR)-6-[4-[(1R)-1-(2-hydroxyethyl)-2,4,4-trimethylcyclohexyl]-2-methylbutan-2-yl]-4a,6,9,9-tetramethyl-4,7,8,8a-tetrahydrobenzo[f][1,2]benzoxazol-5-ylidene]propan-2-one |
| SMILES | CC(=O)/C=C1/[C@@]2(C)Cc3cnoc3C(C)(C)[C@@H]2CC[C@@]1(C)C(C)(C)CC[C@@]1(CCO)CCC(C)(C)CC1C |
| InChI | InChI=1S/C34H55NO3/c1-23-20-29(3,4)13-15-34(23,17-18-36)16-14-30(5,6)33(10)12-11-26-31(7,8)28-25(22-35-38-28)21-32(26,9)27(33)19-24(2)37/h19,22-23,26,36H,11-18,20-21H2,1-10H3/b27-19-/t23?,26-,32-,33+,34+/m0/s1 |
| InChIKey | VJQOORXIGRPORV-KCQGQESGSA-N |
| XLogP | 8.47 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|