C12H30O4S3 — CID 130427062
3-[3-[dimethyl-[(trimethyl-λ4-sulfanyl)methyl]-λ4-sulfanyl]propoxy]propane-1-sulfonic acid (PubChem CID 130427062) has the molecular formula C12H30O4S3 and a molecular weight of 334.57 g/mol. Its IUPAC name is 3-[3-[dimethyl-[(trimethyl-λ4-sulfanyl)methyl]-λ4-sulfanyl]propoxy]propane-1-sulfonic acid.
| Compound Name | 3-[3-[dimethyl-[(trimethyl-λ4-sulfanyl)methyl]-λ4-sulfanyl]propoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 130427062 |
| Molecular Formula | C12H30O4S3 |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[3-[dimethyl-[(trimethyl-λ4-sulfanyl)methyl]-λ4-sulfanyl]propoxy]propane-1-sulfonic acid |
| SMILES | CS(C)(C)CS(C)(C)CCCOCCCS(=O)(=O)O |
| InChI | InChI=1S/C12H30O4S3/c1-17(2,3)12-18(4,5)10-6-8-16-9-7-11-19(13,14)15/h6-12H2,1-5H3,(H,13,14,15) |
| InChIKey | KBRSGZODTOKQIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|