C28H51N — CID 130427110
(2Z,4E)-N-(5-cyclooctylpentyl)-N-methyl-5-[(Z)-prop-1-enyl]undeca-2,4-dien-4-amine (PubChem CID 130427110) has the molecular formula C28H51N and a molecular weight of 401.72 g/mol. Its IUPAC name is (2Z,4E)-N-(5-cyclooctylpentyl)-N-methyl-5-[(Z)-prop-1-enyl]undeca-2,4-dien-4-amine.
| Compound Name | (2Z,4E)-N-(5-cyclooctylpentyl)-N-methyl-5-[(Z)-prop-1-enyl]undeca-2,4-dien-4-amine |
|---|---|
| PubChem CID | 130427110 |
| Molecular Formula | C28H51N |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 401.40 |
| IUPAC Name | (2Z,4E)-N-(5-cyclooctylpentyl)-N-methyl-5-[(Z)-prop-1-enyl]undeca-2,4-dien-4-amine |
| SMILES | C/C=C\C(CCCCCC)=C(/C=C\C)N(C)CCCCCC1CCCCCCC1 |
| InChI | InChI=1S/C28H51N/c1-5-8-9-17-24-27(19-6-2)28(20-7-3)29(4)25-18-13-16-23-26-21-14-11-10-12-15-22-26/h6-7,19-20,26H,5,8-18,21-25H2,1-4H3/b19-6-,20-7-,28-27- |
| InChIKey | GPGXKWPLIJDNRQ-FJAJOSQUSA-N |
| XLogP | 9.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|