C13H16F9NO — CID 130427150
1-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]pyrrolidine (PubChem CID 130427150) has the molecular formula C13H16F9NO and a molecular weight of 373.26 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]pyrrolidine.
| Compound Name | 1-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 130427150 |
| Molecular Formula | C13H16F9NO |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]ethyl]pyrrolidine |
| SMILES | FC(N1CCCC1)C(F)(F)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C13H16F9NO/c14-9(13(20,21)22)11(16,17)7-3-4-8(24-7)12(18,19)10(15)23-5-1-2-6-23/h7-10H,1-6H2 |
| InChIKey | PRCYSRCWDOCENQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|