C10H14F8N2O — CID 130427209
1-[6-(2-amino-1,1,2-trifluoroethyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine (PubChem CID 130427209) has the molecular formula C10H14F8N2O and a molecular weight of 330.22 g/mol. Its IUPAC name is 1-[6-(2-amino-1,1,2-trifluoroethyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine.
| Compound Name | 1-[6-(2-amino-1,1,2-trifluoroethyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
|---|---|
| PubChem CID | 130427209 |
| Molecular Formula | C10H14F8N2O |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 1-[6-(2-amino-1,1,2-trifluoroethyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
| SMILES | NC(F)C(F)(F)C1CCCC(C(F)(F)C(N)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H14F8N2O/c11-7(20)9(14,15)5-3-1-2-4(21-5)8(12,13)6(19)10(16,17)18/h4-7H,1-3,19-20H2 |
| InChIKey | CZVQCGDZISZDFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|