C11H14F10N2O — CID 130427210
1-[6-(2-amino-1,1,3,3,3-pentafluoropropyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine (PubChem CID 130427210) has the molecular formula C11H14F10N2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 1-[6-(2-amino-1,1,3,3,3-pentafluoropropyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine.
| Compound Name | 1-[6-(2-amino-1,1,3,3,3-pentafluoropropyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
|---|---|
| PubChem CID | 130427210 |
| Molecular Formula | C11H14F10N2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-[6-(2-amino-1,1,3,3,3-pentafluoropropyl)oxan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
| SMILES | NC(C(F)(F)F)C(F)(F)C1CCCC(C(F)(F)C(N)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H14F10N2O/c12-8(13,6(22)10(16,17)18)4-2-1-3-5(24-4)9(14,15)7(23)11(19,20)21/h4-7H,1-3,22-23H2 |
| InChIKey | MMDGMXJGBCJGIB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |