C11H8F15NO — CID 130427243
1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)ethanamine (PubChem CID 130427243) has the molecular formula C11H8F15NO and a molecular weight of 455.16 g/mol. Its IUPAC name is 1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)ethanamine.
| Compound Name | 1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)ethanamine |
|---|---|
| PubChem CID | 130427243 |
| Molecular Formula | C11H8F15NO |
| Molecular Weight | 455.16 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 1,2,2-trifluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]-N,N-bis(trifluoromethyl)ethanamine |
| SMILES | FC(N(C(F)(F)F)C(F)(F)F)C(F)(F)C1CCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H8F15NO/c12-5(9(18,19)20)7(14,15)3-1-2-4(28-3)8(16,17)6(13)27(10(21,22)23)11(24,25)26/h3-6H,1-2H2 |
| InChIKey | VTTAPWLTFXQPRZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.16 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|