C16H20F11NO — CID 130427245
1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]azepane (PubChem CID 130427245) has the molecular formula C16H20F11NO and a molecular weight of 451.32 g/mol. Its IUPAC name is 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]azepane.
| Compound Name | 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]azepane |
|---|---|
| PubChem CID | 130427245 |
| Molecular Formula | C16H20F11NO |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[1,2,3,3,3-pentafluoro-2-[5-(1,1,2,3,3,3-hexafluoropropyl)oxolan-2-yl]propyl]azepane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCC(C(F)(C(F)N2CCCCCC2)C(F)(F)F)O1 |
| InChI | InChI=1S/C16H20F11NO/c17-11(15(22,23)24)14(20,21)10-6-5-9(29-10)13(19,16(25,26)27)12(18)28-7-3-1-2-4-8-28/h9-12H,1-8H2 |
| InChIKey | IFACIVLMCYJMGO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|