C15H20F9NO — CID 130427262
1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]piperidine (PubChem CID 130427262) has the molecular formula C15H20F9NO and a molecular weight of 401.31 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]piperidine.
| Compound Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]piperidine |
|---|---|
| PubChem CID | 130427262 |
| Molecular Formula | C15H20F9NO |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]piperidine |
| SMILES | FC(N1CCCCC1)C(F)(F)C1CCCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H20F9NO/c16-11(15(22,23)24)13(18,19)9-5-4-6-10(26-9)14(20,21)12(17)25-7-2-1-3-8-25/h9-12H,1-8H2 |
| InChIKey | MWMZUJPJANXLJA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|