C12H10F15NO — CID 130427266
1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]-N,N-bis(trifluoromethyl)ethanamine (PubChem CID 130427266) has the molecular formula C12H10F15NO and a molecular weight of 469.19 g/mol. Its IUPAC name is 1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]-N,N-bis(trifluoromethyl)ethanamine.
| Compound Name | 1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]-N,N-bis(trifluoromethyl)ethanamine |
|---|---|
| PubChem CID | 130427266 |
| Molecular Formula | C12H10F15NO |
| Molecular Weight | 469.19 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]-N,N-bis(trifluoromethyl)ethanamine |
| SMILES | FC(N(C(F)(F)F)C(F)(F)F)C(F)(F)C1CCCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C12H10F15NO/c13-6(10(19,20)21)8(15,16)4-2-1-3-5(29-4)9(17,18)7(14)28(11(22,23)24)12(25,26)27/h4-7H,1-3H2 |
| InChIKey | GXQUKHUGRYAIJN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.19 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|