C14H18F9NO — CID 130427281
1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]pyrrolidine (PubChem CID 130427281) has the molecular formula C14H18F9NO and a molecular weight of 387.29 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]pyrrolidine.
| Compound Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 130427281 |
| Molecular Formula | C14H18F9NO |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-[1,2,2-trifluoro-2-[6-(1,1,2,3,3,3-hexafluoropropyl)oxan-2-yl]ethyl]pyrrolidine |
| SMILES | FC(N1CCCC1)C(F)(F)C1CCCC(C(F)(F)C(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C14H18F9NO/c15-10(14(21,22)23)12(17,18)8-4-3-5-9(25-8)13(19,20)11(16)24-6-1-2-7-24/h8-11H,1-7H2 |
| InChIKey | YIVVUGRVHBELAF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|