C9H13FN5O4P — CID 130427366
[1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid (PubChem CID 130427366) has the molecular formula C9H13FN5O4P and a molecular weight of 305.21 g/mol. Its IUPAC name is [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid.
| Compound Name | [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 130427366 |
| Molecular Formula | C9H13FN5O4P |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [1-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-3-fluoropropan-2-yl]oxymethylphosphonic acid |
| SMILES | Nc1ncnc2c(CC(CF)OCP(=O)(O)O)cnn12 |
| InChI | InChI=1S/C9H13FN5O4P/c10-2-7(19-5-20(16,17)18)1-6-3-14-15-8(6)12-4-13-9(15)11/h3-4,7H,1-2,5H2,(H2,11,12,13)(H2,16,17,18) |
| InChIKey | DTARHSBYVMSXBD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|