C9H12F8N2O — CID 130427371
2-[5-(2-amino-1,1,2-trifluoroethyl)oxolan-2-yl]-1,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 130427371) has the molecular formula C9H12F8N2O and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-[5-(2-amino-1,1,2-trifluoroethyl)oxolan-2-yl]-1,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 2-[5-(2-amino-1,1,2-trifluoroethyl)oxolan-2-yl]-1,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 130427371 |
| Molecular Formula | C9H12F8N2O |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2-[5-(2-amino-1,1,2-trifluoroethyl)oxolan-2-yl]-1,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | NC(F)C(F)(F)C1CCC(C(F)(C(N)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C9H12F8N2O/c10-5(18)7(12,9(15,16)17)3-1-2-4(20-3)8(13,14)6(11)19/h3-6H,1-2,18-19H2 |
| InChIKey | OVJCKVKEQXZGID-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|