C10H12F10N2O — CID 130427376
1-[5-(3-amino-1,1,1,2,3-pentafluoropropan-2-yl)oxolan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine (PubChem CID 130427376) has the molecular formula C10H12F10N2O and a molecular weight of 366.20 g/mol. Its IUPAC name is 1-[5-(3-amino-1,1,1,2,3-pentafluoropropan-2-yl)oxolan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine.
| Compound Name | 1-[5-(3-amino-1,1,1,2,3-pentafluoropropan-2-yl)oxolan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
|---|---|
| PubChem CID | 130427376 |
| Molecular Formula | C10H12F10N2O |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-[5-(3-amino-1,1,1,2,3-pentafluoropropan-2-yl)oxolan-2-yl]-1,1,3,3,3-pentafluoropropan-2-amine |
| SMILES | NC(C(F)(F)F)C(F)(F)C1CCC(C(F)(C(N)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H12F10N2O/c11-6(22)7(12,10(18,19)20)3-1-2-4(23-3)8(13,14)5(21)9(15,16)17/h3-6H,1-2,21-22H2 |
| InChIKey | WXZCQYKBEIIITJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|