C9H14F2N5O10P3 — CID 130427386
[(2S)-3-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-1,1-difluoropropan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 130427386) has the molecular formula C9H14F2N5O10P3 and a molecular weight of 483.15 g/mol. Its IUPAC name is [(2S)-3-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-1,1-difluoropropan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [(2S)-3-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-1,1-difluoropropan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 130427386 |
| Molecular Formula | C9H14F2N5O10P3 |
| Molecular Weight | 483.15 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | [(2S)-3-(4-aminopyrazolo[1,5-a][1,3,5]triazin-8-yl)-1,1-difluoropropan-2-yl]oxymethyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | Nc1ncnc2c(C[C@H](OCP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(F)F)cnn12 |
| InChI | InChI=1S/C9H14F2N5O10P3/c10-7(11)6(1-5-2-15-16-8(5)13-3-14-9(16)12)24-4-27(17,18)25-29(22,23)26-28(19,20)21/h2-3,6-7H,1,4H2,(H,17,18)(H,22,23)(H2,12,13,14)(H2,19,20,21)/t6-/m0/s1 |
| InChIKey | TXXQWQCPGWGWHO-LURJTMIESA-N |
| XLogP | 0.27 |
| TPSA | 228.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|