C17H15FN2O4S2 — CID 130428082
2-(4-fluorophenyl)-3-[2-methyl-4-(sulfinocarbamoyl)phenyl]-4-oxo-1,3-thiazolidine (PubChem CID 130428082) has the molecular formula C17H15FN2O4S2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-[2-methyl-4-(sulfinocarbamoyl)phenyl]-4-oxo-1,3-thiazolidine.
| Compound Name | 2-(4-fluorophenyl)-3-[2-methyl-4-(sulfinocarbamoyl)phenyl]-4-oxo-1,3-thiazolidine |
|---|---|
| PubChem CID | 130428082 |
| Molecular Formula | C17H15FN2O4S2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-(4-fluorophenyl)-3-[2-methyl-4-(sulfinocarbamoyl)phenyl]-4-oxo-1,3-thiazolidine |
| SMILES | Cc1cc(C(=O)NS(=O)O)ccc1N1C(=O)CSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O4S2/c1-10-8-12(16(22)19-26(23)24)4-7-14(10)20-15(21)9-25-17(20)11-2-5-13(18)6-3-11/h2-8,17H,9H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | OZOPWTOIEVKKGU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|