About (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene
(2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene (PubChem CID 130428139) has the molecular formula C10H18S
and a molecular weight of 170.32 g/mol. Its IUPAC name is (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene |
| PubChem CID | 130428139 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene |
| SMILES | C/C=C\C(=C/CC)C(C)SC |
| InChI | InChI=1S/C10H18S/c1-5-7-10(8-6-2)9(3)11-4/h5,7-9H,6H2,1-4H3/b7-5-,10-8+ |
| InChIKey | FYJOVQMGQOJLLS-SUTBWYPISA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene?
The IUPAC name of (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene (CID 130428139) is (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene.
What is the SMILES notation for (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene?
The canonical SMILES for (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene is C/C=C\C(=C/CC)C(C)SC.
What is the InChIKey of (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene?
The InChIKey is FYJOVQMGQOJLLS-SUTBWYPISA-N. The full InChI is InChI=1S/C10H18S/c1-5-7-10(8-6-2)9(3)11-4/h5,7-9H,6H2,1-4H3/b7-5-,10-8+.
What are the key properties of (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene?
(2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene has a molecular weight of 170.32 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-(1-methylsulfanylethyl)hepta-2,4-diene is sourced from PubChem (CID 130428139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).