About (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine
(2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine (PubChem CID 130428227) has the molecular formula C6H10FN
and a molecular weight of 115.15 g/mol. Its IUPAC name is (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine |
| PubChem CID | 130428227 |
| Molecular Formula | C6H10FN |
| Molecular Weight | 115.15 g/mol |
| Exact Mass | 115.08 |
| IUPAC Name | (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine |
| SMILES | C=C(F)/C=C(\C)NC |
| InChI | InChI=1S/C6H10FN/c1-5(7)4-6(2)8-3/h4,8H,1H2,2-3H3/b6-4+ |
| InChIKey | UGLFPWCOFTYLLP-GQCTYLIASA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine?
The IUPAC name of (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine (CID 130428227) is (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine?
The canonical SMILES for (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine is C=C(F)/C=C(\C)NC.
What is the InChIKey of (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine?
The InChIKey is UGLFPWCOFTYLLP-GQCTYLIASA-N. The full InChI is InChI=1S/C6H10FN/c1-5(7)4-6(2)8-3/h4,8H,1H2,2-3H3/b6-4+.
What are the key properties of (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine?
(2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine has a molecular weight of 115.15 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-fluoro-N-methylpenta-2,4-dien-2-amine is sourced from PubChem (CID 130428227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).