About 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine
7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 130428247) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine.
Molecular Properties
| Compound Name | 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine |
| PubChem CID | 130428247 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine |
| SMILES | CC1(F)C=Cc2ncnn2C=C1 |
| InChI | InChI=1S/C8H8FN3/c1-8(9)3-2-7-10-6-11-12(7)5-4-8/h2-6H,1H3 |
| InChIKey | HUBXFLLWQSNXHM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine?
The IUPAC name of 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine (CID 130428247) is 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine.
What is the SMILES notation for 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine?
The canonical SMILES for 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine is CC1(F)C=Cc2ncnn2C=C1.
What is the InChIKey of 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine?
The InChIKey is HUBXFLLWQSNXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3/c1-8(9)3-2-7-10-6-11-12(7)5-4-8/h2-6H,1H3.
What are the key properties of 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine?
7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine has a molecular weight of 165.17 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-7-methyl-[1,2,4]triazolo[1,5-a]azepine is sourced from PubChem (CID 130428247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).