C29H53FO3 — CID 130428285
(7Z,16Z)-22-fluoro-2-(3-methoxy-3-methylbutoxy)-2-methyldocosa-7,16-dien-3-one (PubChem CID 130428285) has the molecular formula C29H53FO3 and a molecular weight of 468.74 g/mol. Its IUPAC name is (7Z,16Z)-22-fluoro-2-(3-methoxy-3-methylbutoxy)-2-methyldocosa-7,16-dien-3-one.
| Compound Name | (7Z,16Z)-22-fluoro-2-(3-methoxy-3-methylbutoxy)-2-methyldocosa-7,16-dien-3-one |
|---|---|
| PubChem CID | 130428285 |
| Molecular Formula | C29H53FO3 |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (7Z,16Z)-22-fluoro-2-(3-methoxy-3-methylbutoxy)-2-methyldocosa-7,16-dien-3-one |
| SMILES | COC(C)(C)CCOC(C)(C)C(=O)CCC/C=C\CCCCCCC/C=C\CCCCCF |
| InChI | InChI=1S/C29H53FO3/c1-28(2,32-5)24-26-33-29(3,4)27(31)23-21-19-17-15-13-11-9-7-6-8-10-12-14-16-18-20-22-25-30/h12,14-15,17H,6-11,13,16,18-26H2,1-5H3/b14-12-,17-15- |
| InChIKey | BYPBLPZQUQJSQF-NERFDCTISA-N |
| XLogP | 8.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|