C12H16O4 — CID 13042860
diethyl cyclohexa-1,4-diene-1,2-dicarboxylate (PubChem CID 13042860) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is diethyl cyclohexa-1,4-diene-1,2-dicarboxylate.
| Compound Name | diethyl cyclohexa-1,4-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 13042860 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | diethyl cyclohexa-1,4-diene-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)CC=CC1 |
| InChI | InChI=1S/C12H16O4/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | QOQXBXXGLQDEJC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|