C22H22N6O2 — CID 130428690
N-(2-cyanoethyl)-5-[6-[2-(2-methoxyphenyl)ethylamino]pyrimidin-4-yl]pyridine-2-carboxamide (PubChem CID 130428690) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-5-[6-[2-(2-methoxyphenyl)ethylamino]pyrimidin-4-yl]pyridine-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-5-[6-[2-(2-methoxyphenyl)ethylamino]pyrimidin-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130428690 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2-cyanoethyl)-5-[6-[2-(2-methoxyphenyl)ethylamino]pyrimidin-4-yl]pyridine-2-carboxamide |
| SMILES | COc1ccccc1CCNc1cc(-c2ccc(C(=O)NCCC#N)nc2)ncn1 |
| InChI | InChI=1S/C22H22N6O2/c1-30-20-6-3-2-5-16(20)9-12-24-21-13-19(27-15-28-21)17-7-8-18(26-14-17)22(29)25-11-4-10-23/h2-3,5-8,13-15H,4,9,11-12H2,1H3,(H,25,29)(H,24,27,28) |
| InChIKey | AGZVXYWSYYNWMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|