C16H16ClN5 — CID 130429151
5-(3-aminophenyl)-N-[(2-chloro-6-methylphenyl)methyl]-1H-1,2,4-triazol-3-amine (PubChem CID 130429151) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is 5-(3-aminophenyl)-N-[(2-chloro-6-methylphenyl)methyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-aminophenyl)-N-[(2-chloro-6-methylphenyl)methyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130429151 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-(3-aminophenyl)-N-[(2-chloro-6-methylphenyl)methyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1cccc(Cl)c1CNc1n[nH]c(-c2cccc(N)c2)n1 |
| InChI | InChI=1S/C16H16ClN5/c1-10-4-2-7-14(17)13(10)9-19-16-20-15(21-22-16)11-5-3-6-12(18)8-11/h2-8H,9,18H2,1H3,(H2,19,20,21,22) |
| InChIKey | ZAOBYKPTJORGPB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|