C17H14ClFN4O2 — CID 130429241
[3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl] acetate (PubChem CID 130429241) has the molecular formula C17H14ClFN4O2 and a molecular weight of 360.78 g/mol. Its IUPAC name is [3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl] acetate.
| Compound Name | [3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 130429241 |
| Molecular Formula | C17H14ClFN4O2 |
| Molecular Weight | 360.78 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [3-[3-[(2-chloro-6-fluorophenyl)methylamino]-1H-1,2,4-triazol-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(-c2nc(NCc3c(F)cccc3Cl)n[nH]2)c1 |
| InChI | InChI=1S/C17H14ClFN4O2/c1-10(24)25-12-5-2-4-11(8-12)16-21-17(23-22-16)20-9-13-14(18)6-3-7-15(13)19/h2-8H,9H2,1H3,(H2,20,21,22,23) |
| InChIKey | RSCYDMTVGWZZFC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|