C33H63N9O — CID 130429280
(22R)-27-ethyl-22,34-dimethyl-9-oxa-1,2,12,14,17,20,27,30,32-nonazaheptacyclo[30.2.2.214,17.18,12.02,7.019,24.025,30]nonatriacontane (PubChem CID 130429280) has the molecular formula C33H63N9O and a molecular weight of 601.93 g/mol. Its IUPAC name is (22R)-27-ethyl-22,34-dimethyl-9-oxa-1,2,12,14,17,20,27,30,32-nonazaheptacyclo[30.2.2.214,17.18,12.02,7.019,24.025,30]nonatriacontane.
| Compound Name | (22R)-27-ethyl-22,34-dimethyl-9-oxa-1,2,12,14,17,20,27,30,32-nonazaheptacyclo[30.2.2.214,17.18,12.02,7.019,24.025,30]nonatriacontane |
|---|---|
| PubChem CID | 130429280 |
| Molecular Formula | C33H63N9O |
| Molecular Weight | 601.93 g/mol |
| Exact Mass | 601.52 |
| IUPAC Name | (22R)-27-ethyl-22,34-dimethyl-9-oxa-1,2,12,14,17,20,27,30,32-nonazaheptacyclo[30.2.2.214,17.18,12.02,7.019,24.025,30]nonatriacontane |
| SMILES | CCN1CCN2CN3CCN(C(C)C3)N3CCCCC3C3CN(CCO3)CN3CCN(CC3)CC3NC[C@H](C)CC3C2C1 |
| InChI | InChI=1S/C33H63N9O/c1-4-35-13-15-40-26-38-14-16-41(28(3)21-38)42-8-6-5-7-31(42)33-24-39(17-18-43-33)25-37-11-9-36(10-12-37)22-30-29(32(40)23-35)19-27(2)20-34-30/h27-34H,4-26H2,1-3H3/t27-,28?,29?,30?,31?,32?,33?/m1/s1 |
| InChIKey | PDOYIHXZAIDJFL-BNKOWOFLSA-N |
| XLogP | 0.63 |
| TPSA | 47.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.93 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |