C17H13O3PS2 — CID 130429314
2'-phenylspiro[1,3-dioxolane-2,8'-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraene] 2'-oxide (PubChem CID 130429314) has the molecular formula C17H13O3PS2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2'-phenylspiro[1,3-dioxolane-2,8'-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraene] 2'-oxide.
| Compound Name | 2'-phenylspiro[1,3-dioxolane-2,8'-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraene] 2'-oxide |
|---|---|
| PubChem CID | 130429314 |
| Molecular Formula | C17H13O3PS2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2'-phenylspiro[1,3-dioxolane-2,8'-6,10-dithia-2λ5-phosphatricyclo[7.3.0.03,7]dodeca-1(9),3(7),4,11-tetraene] 2'-oxide |
| SMILES | O=P1(c2ccccc2)c2ccsc2C2(OCCO2)c2sccc21 |
| InChI | InChI=1S/C17H13O3PS2/c18-21(12-4-2-1-3-5-12)13-6-10-22-15(13)17(19-8-9-20-17)16-14(21)7-11-23-16/h1-7,10-11H,8-9H2 |
| InChIKey | IHTWPXUXTMFDFY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|