C32H53BrO7 — CID 130429324
[(R)-(4-bromo-2-methylphenyl)-[(2R,4S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]methyl] acetate (PubChem CID 130429324) has the molecular formula C32H53BrO7 and a molecular weight of 629.67 g/mol. Its IUPAC name is [(R)-(4-bromo-2-methylphenyl)-[(2R,4S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]methyl] acetate.
| Compound Name | [(R)-(4-bromo-2-methylphenyl)-[(2R,4S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]methyl] acetate |
|---|---|
| PubChem CID | 130429324 |
| Molecular Formula | C32H53BrO7 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | [(R)-(4-bromo-2-methylphenyl)-[(2R,4S,5R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]methyl] acetate |
| SMILES | CCCCOCC1O[C@H]([C@H](OC(C)=O)c2ccc(Br)cc2C)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C32H53BrO7/c1-7-11-17-35-22-27-29(36-18-12-8-2)30(37-19-13-9-3)31(38-20-14-10-4)32(40-27)28(39-24(6)34)26-16-15-25(33)21-23(26)5/h15-16,21,27-32H,7-14,17-20,22H2,1-6H3/t27?,28-,29-,30+,31?,32-/m1/s1 |
| InChIKey | QJVQPTGWEOEUKO-WQZJOPOTSA-N |
| XLogP | 7.50 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|