C14H21N — CID 130429507
1,4,5,6,7-pentamethyl-2,3-dihydroinden-1-amine (PubChem CID 130429507) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,4,5,6,7-pentamethyl-2,3-dihydroinden-1-amine.
| Compound Name | 1,4,5,6,7-pentamethyl-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 130429507 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1,4,5,6,7-pentamethyl-2,3-dihydroinden-1-amine |
| SMILES | Cc1c(C)c(C)c2c(c1C)CCC2(C)N |
| InChI | InChI=1S/C14H21N/c1-8-9(2)11(4)13-12(10(8)3)6-7-14(13,5)15/h6-7,15H2,1-5H3 |
| InChIKey | IODUNXQXFYXRAT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |