About ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate
ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 13042964) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 13042964 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCOC(=O)N1CC=CC(O)C1 |
| InChI | InChI=1S/C8H13NO3/c1-2-12-8(11)9-5-3-4-7(10)6-9/h3-4,7,10H,2,5-6H2,1H3 |
| InChIKey | HDWVZWCHYNYDFC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate (CID 13042964) is ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate is CCOC(=O)N1CC=CC(O)C1.
What is the InChIKey of ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is HDWVZWCHYNYDFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-2-12-8(11)9-5-3-4-7(10)6-9/h3-4,7,10H,2,5-6H2,1H3.
What are the key properties of ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate?
ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 171.20 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 13042964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).