C10H13F3O2S — CID 130429664
(3Z,5Z)-4,5-dimethyl-2-(trifluoromethylsulfonyl)hepta-1,3,5-triene (PubChem CID 130429664) has the molecular formula C10H13F3O2S and a molecular weight of 254.27 g/mol. Its IUPAC name is (3Z,5Z)-4,5-dimethyl-2-(trifluoromethylsulfonyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-4,5-dimethyl-2-(trifluoromethylsulfonyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 130429664 |
| Molecular Formula | C10H13F3O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (3Z,5Z)-4,5-dimethyl-2-(trifluoromethylsulfonyl)hepta-1,3,5-triene |
| SMILES | C=C(/C=C(C)\C(C)=C/C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O2S/c1-5-7(2)8(3)6-9(4)16(14,15)10(11,12)13/h5-6H,4H2,1-3H3/b7-5-,8-6- |
| InChIKey | GGOMKRFBINEGJL-SFECMWDFSA-N |
| XLogP | 3.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|