C24H26N6O — CID 130430006
2-[1-(cyclopentylmethyl)indazol-3-yl]-5-methoxy-N-(3-methyl-4-pyridinyl)pyrimidin-4-amine (PubChem CID 130430006) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[1-(cyclopentylmethyl)indazol-3-yl]-5-methoxy-N-(3-methyl-4-pyridinyl)pyrimidin-4-amine.
| Compound Name | 2-[1-(cyclopentylmethyl)indazol-3-yl]-5-methoxy-N-(3-methyl-4-pyridinyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 130430006 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[1-(cyclopentylmethyl)indazol-3-yl]-5-methoxy-N-(3-methyl-4-pyridinyl)pyrimidin-4-amine |
| SMILES | COc1cnc(-c2nn(CC3CCCC3)c3ccccc23)nc1Nc1ccncc1C |
| InChI | InChI=1S/C24H26N6O/c1-16-13-25-12-11-19(16)27-23-21(31-2)14-26-24(28-23)22-18-9-5-6-10-20(18)30(29-22)15-17-7-3-4-8-17/h5-6,9-14,17H,3-4,7-8,15H2,1-2H3,(H,25,26,27,28) |
| InChIKey | FZHPTZTUSMAWRO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |