C24H28F3N3O3 — CID 130430145
6-[[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione (PubChem CID 130430145) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is 6-[[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione.
| Compound Name | 6-[[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
|---|---|
| PubChem CID | 130430145 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 6-[[1-(3,5-dimethylphenyl)cyclopentyl]methyl]-9-hydroxy-2-[(2R)-1,1,1-trifluoropropan-2-yl]-3,4-dihydropyrazino[1,2-c]pyrimidine-1,8-dione |
| SMILES | Cc1cc(C)cc(C2(Cc3nc(=O)c(O)c4n3CCN([C@H](C)C(F)(F)F)C4=O)CCCC2)c1 |
| InChI | InChI=1S/C24H28F3N3O3/c1-14-10-15(2)12-17(11-14)23(6-4-5-7-23)13-18-28-21(32)20(31)19-22(33)29(8-9-30(18)19)16(3)24(25,26)27/h10-12,16,31H,4-9,13H2,1-3H3/t16-/m1/s1 |
| InChIKey | CIZVHXBXQKCQTD-MRXNPFEDSA-N |
| XLogP | 4.03 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |