About (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one
(6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one (PubChem CID 130430312) has the molecular formula C8H13F3N2O
and a molecular weight of 210.20 g/mol. Its IUPAC name is (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one.
Molecular Properties
| Compound Name | (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one |
| PubChem CID | 130430312 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one |
| SMILES | C[C@@H]1CNCC(=O)N1[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O/c1-5-3-12-4-7(14)13(5)6(2)8(9,10)11/h5-6,12H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | PVSSVQNIHIDTIU-PHDIDXHHSA-N |
| XLogP | 0.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one?
The IUPAC name of (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one (CID 130430312) is (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one.
What is the SMILES notation for (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one?
The canonical SMILES for (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one is C[C@@H]1CNCC(=O)N1[C@H](C)C(F)(F)F.
What is the InChIKey of (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one?
The InChIKey is PVSSVQNIHIDTIU-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H13F3N2O/c1-5-3-12-4-7(14)13(5)6(2)8(9,10)11/h5-6,12H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one?
(6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one has a molecular weight of 210.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-1-[(2R)-1,1,1-trifluoropropan-2-yl]piperazin-2-one is sourced from PubChem (CID 130430312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).