C15H13N5O2 — CID 130431023
3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 130431023) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
| Compound Name | 3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 130431023 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | N#CN1Cc2[nH]nc(-c3cccc(N4CCOC4=O)c3)c2C1 |
| InChI | InChI=1S/C15H13N5O2/c16-9-19-7-12-13(8-19)17-18-14(12)10-2-1-3-11(6-10)20-4-5-22-15(20)21/h1-3,6H,4-5,7-8H2,(H,17,18) |
| InChIKey | UABKLFAPPJJCBC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|