C17H19FN6 — CID 130431049
3-[2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 130431049) has the molecular formula C17H19FN6 and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-[2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
| Compound Name | 3-[2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 130431049 |
| Molecular Formula | C17H19FN6 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[2-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | CN1CCN(c2ccc(-c3n[nH]c4c3CN(C#N)C4)c(F)c2)CC1 |
| InChI | InChI=1S/C17H19FN6/c1-22-4-6-24(7-5-22)12-2-3-13(15(18)8-12)17-14-9-23(11-19)10-16(14)20-21-17/h2-3,8H,4-7,9-10H2,1H3,(H,20,21) |
| InChIKey | OTMHRZKJSLANPT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|