About tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate
tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (PubChem CID 130431052) has the molecular formula C16H18FN3O2
and a molecular weight of 303.34 g/mol. Its IUPAC name is tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| PubChem CID | 130431052 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2[nH]nc(-c3cccc(F)c3)c2C1 |
| InChI | InChI=1S/C16H18FN3O2/c1-16(2,3)22-15(21)20-8-12-13(9-20)18-19-14(12)10-5-4-6-11(17)7-10/h4-7H,8-9H2,1-3H3,(H,18,19) |
| InChIKey | FKNGLRNMGNEZSU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate?
The IUPAC name of tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate (CID 130431052) is tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate.
What is the SMILES notation for tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate?
The canonical SMILES for tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate is CC(C)(C)OC(=O)N1Cc2[nH]nc(-c3cccc(F)c3)c2C1.
What is the InChIKey of tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate?
The InChIKey is FKNGLRNMGNEZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN3O2/c1-16(2,3)22-15(21)20-8-12-13(9-20)18-19-14(12)10-5-4-6-11(17)7-10/h4-7H,8-9H2,1-3H3,(H,18,19).
What are the key properties of tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate?
tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate has a molecular weight of 303.34 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(3-fluorophenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carboxylate is sourced from PubChem (CID 130431052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).