About 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile
1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 130431080) has the molecular formula C13H10N6
and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile |
| PubChem CID | 130431080 |
| Molecular Formula | C13H10N6 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | N#CN1Cc2cnn(-c3n[nH]c4ccccc34)c2C1 |
| InChI | InChI=1S/C13H10N6/c14-8-18-6-9-5-15-19(12(9)7-18)13-10-3-1-2-4-11(10)16-17-13/h1-5H,6-7H2,(H,16,17) |
| InChIKey | XXGXMUVQOXAODU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile?
The IUPAC name of 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile (CID 130431080) is 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile.
What is the SMILES notation for 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile?
The canonical SMILES for 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile is N#CN1Cc2cnn(-c3n[nH]c4ccccc34)c2C1.
What is the InChIKey of 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile?
The InChIKey is XXGXMUVQOXAODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N6/c14-8-18-6-9-5-15-19(12(9)7-18)13-10-3-1-2-4-11(10)16-17-13/h1-5H,6-7H2,(H,16,17).
What are the key properties of 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile?
1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile has a molecular weight of 250.26 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-indazol-3-yl)-4,6-dihydropyrrolo[3,4-d]pyrazole-5-carbonitrile is sourced from PubChem (CID 130431080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).