C15H15FN4O — CID 130431085
3-(5-fluoro-2-propan-2-yloxyphenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile (PubChem CID 130431085) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-(5-fluoro-2-propan-2-yloxyphenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile.
| Compound Name | 3-(5-fluoro-2-propan-2-yloxyphenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 130431085 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-(5-fluoro-2-propan-2-yloxyphenyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-5-carbonitrile |
| SMILES | CC(C)Oc1ccc(F)cc1-c1n[nH]c2c1CN(C#N)C2 |
| InChI | InChI=1S/C15H15FN4O/c1-9(2)21-14-4-3-10(16)5-11(14)15-12-6-20(8-17)7-13(12)18-19-15/h3-5,9H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | LYAPAMVUYLIWDO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|