C58H48N8O2 — CID 130431244
benzyl N-[3-(1-methylpyrazol-4-yl)-3-[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]prop-2-enyl]carbamate (PubChem CID 130431244) has the molecular formula C58H48N8O2 and a molecular weight of 889.08 g/mol. Its IUPAC name is benzyl N-[3-(1-methylpyrazol-4-yl)-3-[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-(1-methylpyrazol-4-yl)-3-[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 130431244 |
| Molecular Formula | C58H48N8O2 |
| Molecular Weight | 889.08 g/mol |
| Exact Mass | 888.39 |
| IUPAC Name | benzyl N-[3-(1-methylpyrazol-4-yl)-3-[3-trityl-5-(tritylamino)triazolo[4,5-b]pyridin-7-yl]prop-2-enyl]carbamate |
| SMILES | Cn1cc(C(=CCNC(=O)OCc2ccccc2)c2cc(NC(c3ccccc3)(c3ccccc3)c3ccccc3)nc3c2nnn3C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C58H48N8O2/c1-65-41-44(40-60-65)51(37-38-59-56(67)68-42-43-23-9-2-10-24-43)52-39-53(62-57(45-25-11-3-12-26-45,46-27-13-4-14-28-46)47-29-15-5-16-30-47)61-55-54(52)63-64-66(55)58(48-31-17-6-18-32-48,49-33-19-7-20-34-49)50-35-21-8-22-36-50/h2-37,39-41H,38,42H2,1H3,(H,59,67)(H,61,62) |
| InChIKey | CGMFTUUHEJFFBL-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.08 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|