C25H26N8O2 — CID 130431245
3-[[[3-(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)-3-[1-[(3-hydroxyphenyl)methyl]pyrazol-4-yl]propyl]amino]methyl]phenol (PubChem CID 130431245) has the molecular formula C25H26N8O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 3-[[[3-(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)-3-[1-[(3-hydroxyphenyl)methyl]pyrazol-4-yl]propyl]amino]methyl]phenol.
| Compound Name | 3-[[[3-(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)-3-[1-[(3-hydroxyphenyl)methyl]pyrazol-4-yl]propyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 130431245 |
| Molecular Formula | C25H26N8O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 3-[[[3-(5-amino-2H-triazolo[4,5-b]pyridin-7-yl)-3-[1-[(3-hydroxyphenyl)methyl]pyrazol-4-yl]propyl]amino]methyl]phenol |
| SMILES | Nc1cc(C(CCNCc2cccc(O)c2)c2cnn(Cc3cccc(O)c3)c2)c2n[nH]nc2n1 |
| InChI | InChI=1S/C25H26N8O2/c26-23-11-22(24-25(29-23)31-32-30-24)21(7-8-27-12-16-3-1-5-19(34)9-16)18-13-28-33(15-18)14-17-4-2-6-20(35)10-17/h1-6,9-11,13,15,21,27,34-35H,7-8,12,14H2,(H3,26,29,30,31,32) |
| InChIKey | GRPIXMCMPZFKSF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 150.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|