C24H30ClN5O — CID 130431343
N-[4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 130431343) has the molecular formula C24H30ClN5O and a molecular weight of 439.99 g/mol. Its IUPAC name is N-[4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130431343 |
| Molecular Formula | C24H30ClN5O |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-[4-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]butyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CCc1cccc(N2CCN(CCCCNC(=O)c3cn4ccccc4n3)CC2)c1Cl |
| InChI | InChI=1S/C24H30ClN5O/c1-2-19-8-7-9-21(23(19)25)29-16-14-28(15-17-29)12-6-4-11-26-24(31)20-18-30-13-5-3-10-22(30)27-20/h3,5,7-10,13,18H,2,4,6,11-12,14-17H2,1H3,(H,26,31) |
| InChIKey | ADGRZRHCVXPKAN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|