C28H27N5O2 — CID 130431355
3-(2-hydroxycyclohexyl)-6-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzo[f]phthalazin-4-one (PubChem CID 130431355) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 3-(2-hydroxycyclohexyl)-6-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzo[f]phthalazin-4-one.
| Compound Name | 3-(2-hydroxycyclohexyl)-6-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzo[f]phthalazin-4-one |
|---|---|
| PubChem CID | 130431355 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 3-(2-hydroxycyclohexyl)-6-[[6-(1-methylpyrazol-4-yl)-3-pyridinyl]methyl]benzo[f]phthalazin-4-one |
| SMILES | Cn1cc(-c2ccc(Cc3cc4c(=O)n(C5CCCCC5O)ncc4c4ccccc34)cn2)cn1 |
| InChI | InChI=1S/C28H27N5O2/c1-32-17-20(15-30-32)25-11-10-18(14-29-25)12-19-13-23-24(22-7-3-2-6-21(19)22)16-31-33(28(23)35)26-8-4-5-9-27(26)34/h2-3,6-7,10-11,13-17,26-27,34H,4-5,8-9,12H2,1H3 |
| InChIKey | IRKULIPQNKMEGV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|