C21H17Cl3N2O3S — CID 130431448
N-[[4-(benzenesulfonamidomethyl)phenyl]methyl]-2,4,6-trichlorobenzamide (PubChem CID 130431448) has the molecular formula C21H17Cl3N2O3S and a molecular weight of 483.80 g/mol. Its IUPAC name is N-[[4-(benzenesulfonamidomethyl)phenyl]methyl]-2,4,6-trichlorobenzamide.
| Compound Name | N-[[4-(benzenesulfonamidomethyl)phenyl]methyl]-2,4,6-trichlorobenzamide |
|---|---|
| PubChem CID | 130431448 |
| Molecular Formula | C21H17Cl3N2O3S |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | N-[[4-(benzenesulfonamidomethyl)phenyl]methyl]-2,4,6-trichlorobenzamide |
| SMILES | O=C(NCc1ccc(CNS(=O)(=O)c2ccccc2)cc1)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl3N2O3S/c22-16-10-18(23)20(19(24)11-16)21(27)25-12-14-6-8-15(9-7-14)13-26-30(28,29)17-4-2-1-3-5-17/h1-11,26H,12-13H2,(H,25,27) |
| InChIKey | KGUKYLGBKJTXEP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |