About N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide
N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide (PubChem CID 130431457) has the molecular formula C19H16F2N4O3S
and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide |
| PubChem CID | 130431457 |
| Molecular Formula | C19H16F2N4O3S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide |
| SMILES | O=C(NCc1ccc(CNS(=O)(=O)c2ccc(F)cc2F)cc1)c1cncnc1 |
| InChI | InChI=1S/C19H16F2N4O3S/c20-16-5-6-18(17(21)7-16)29(27,28)25-9-14-3-1-13(2-4-14)8-24-19(26)15-10-22-12-23-11-15/h1-7,10-12,25H,8-9H2,(H,24,26) |
| InChIKey | HLTWLUMGQHBDCU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide?
The IUPAC name of N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide (CID 130431457) is N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide.
What is the SMILES notation for N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide?
The canonical SMILES for N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide is O=C(NCc1ccc(CNS(=O)(=O)c2ccc(F)cc2F)cc1)c1cncnc1.
What is the InChIKey of N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide?
The InChIKey is HLTWLUMGQHBDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N4O3S/c20-16-5-6-18(17(21)7-16)29(27,28)25-9-14-3-1-13(2-4-14)8-24-19(26)15-10-22-12-23-11-15/h1-7,10-12,25H,8-9H2,(H,24,26).
What are the key properties of N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide?
N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide has a molecular weight of 418.43 g/mol, XLogP of 2.16, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[[(2,4-difluorophenyl)sulfonylamino]methyl]phenyl]methyl]pyrimidine-5-carboxamide is sourced from PubChem (CID 130431457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).