About 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine
2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine (PubChem CID 130431796) has the molecular formula C30H28N4
and a molecular weight of 444.58 g/mol. Its IUPAC name is 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine.
Molecular Properties
| Compound Name | 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine |
| PubChem CID | 130431796 |
| Molecular Formula | C30H28N4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine |
| SMILES | Cc1ccc(C)n1-c1cc(/C(=C/c2ccccn2)c2ccccc2)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C30H28N4/c1-21-13-14-22(2)33(21)29-18-26(19-30(32-29)34-23(3)15-16-24(34)4)28(25-10-6-5-7-11-25)20-27-12-8-9-17-31-27/h5-20H,1-4H3/b28-20+ |
| InChIKey | CRRQAVKRCWWVLH-VFCFBJKWSA-N |
| XLogP | 6.88 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine?
The IUPAC name of 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine (CID 130431796) is 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine.
What is the SMILES notation for 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine?
The canonical SMILES for 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine is Cc1ccc(C)n1-c1cc(/C(=C/c2ccccn2)c2ccccc2)cc(-n2c(C)ccc2C)n1.
What is the InChIKey of 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine?
The InChIKey is CRRQAVKRCWWVLH-VFCFBJKWSA-N. The full InChI is InChI=1S/C30H28N4/c1-21-13-14-22(2)33(21)29-18-26(19-30(32-29)34-23(3)15-16-24(34)4)28(25-10-6-5-7-11-25)20-27-12-8-9-17-31-27/h5-20H,1-4H3/b28-20+.
What are the key properties of 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine?
2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine has a molecular weight of 444.58 g/mol, XLogP of 6.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2,5-dimethylpyrrol-1-yl)-4-[(E)-1-phenyl-2-pyridin-2-ylethenyl]pyridine is sourced from PubChem (CID 130431796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).