C13H14N4 — CID 130432362
8-methyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),14-pentaene (PubChem CID 130432362) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 8-methyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),14-pentaene.
| Compound Name | 8-methyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),14-pentaene |
|---|---|
| PubChem CID | 130432362 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 8-methyl-1,3,6,8-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,11(16),14-pentaene |
| SMILES | CN1c2nccnc2N2C3=C(CCC=C3)CC12 |
| InChI | InChI=1S/C13H14N4/c1-16-11-8-9-4-2-3-5-10(9)17(11)13-12(16)14-6-7-15-13/h3,5-7,11H,2,4,8H2,1H3 |
| InChIKey | LJJUUUWAQLTLPQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |