C14HF11O4S — CID 130432420
(2,3,5,6-tetrafluorophenyl) 2,3,5,6-tetrafluoro-4-(trifluoromethylsulfonyl)benzoate (PubChem CID 130432420) has the molecular formula C14HF11O4S and a molecular weight of 474.20 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2,3,5,6-tetrafluoro-4-(trifluoromethylsulfonyl)benzoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2,3,5,6-tetrafluoro-4-(trifluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 130432420 |
| Molecular Formula | C14HF11O4S |
| Molecular Weight | 474.20 g/mol |
| Exact Mass | 473.94 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2,3,5,6-tetrafluoro-4-(trifluoromethylsulfonyl)benzoate |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)c1c(F)c(F)c(S(=O)(=O)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14HF11O4S/c15-2-1-3(16)6(18)11(5(2)17)29-13(26)4-7(19)9(21)12(10(22)8(4)20)30(27,28)14(23,24)25/h1H |
| InChIKey | RHLHRXPPKAIHDL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|