About [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane
[(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane (PubChem CID 13043253) has the molecular formula C8H15BrSi
and a molecular weight of 219.20 g/mol. Its IUPAC name is [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane |
| PubChem CID | 13043253 |
| Molecular Formula | C8H15BrSi |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane |
| SMILES | C=CC/C=C(\Br)[Si](C)(C)C |
| InChI | InChI=1S/C8H15BrSi/c1-5-6-7-8(9)10(2,3)4/h5,7H,1,6H2,2-4H3/b8-7+ |
| InChIKey | USRJTXZSCJDPDE-BQYQJAHWSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane?
The IUPAC name of [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane (CID 13043253) is [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane.
What is the SMILES notation for [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane?
The canonical SMILES for [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane is C=CC/C=C(\Br)[Si](C)(C)C.
What is the InChIKey of [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane?
The InChIKey is USRJTXZSCJDPDE-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H15BrSi/c1-5-6-7-8(9)10(2,3)4/h5,7H,1,6H2,2-4H3/b8-7+.
What are the key properties of [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane?
[(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane has a molecular weight of 219.20 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-1-bromopenta-1,4-dienyl]-trimethylsilane is sourced from PubChem (CID 13043253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).