About 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide
5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide (PubChem CID 130433020) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide |
| PubChem CID | 130433020 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide |
| SMILES | CC(=O)C1CC(C(N)=O)CC2CC(C1)C(=O)NC2=O |
| InChI | InChI=1S/C13H18N2O4/c1-6(16)7-2-8(11(14)17)4-10-5-9(3-7)12(18)15-13(10)19/h7-10H,2-5H2,1H3,(H2,14,17)(H,15,18,19) |
| InChIKey | QMDWKHLJKDAAQU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide?
The IUPAC name of 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide (CID 130433020) is 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide.
What is the SMILES notation for 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide?
The canonical SMILES for 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide is CC(=O)C1CC(C(N)=O)CC2CC(C1)C(=O)NC2=O.
What is the InChIKey of 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide?
The InChIKey is QMDWKHLJKDAAQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-6(16)7-2-8(11(14)17)4-10-5-9(3-7)12(18)15-13(10)19/h7-10H,2-5H2,1H3,(H2,14,17)(H,15,18,19).
What are the key properties of 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide?
5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide has a molecular weight of 266.30 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-8,10-dioxo-9-azabicyclo[5.3.1]undecane-3-carboxamide is sourced from PubChem (CID 130433020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).